A1448712
2-Bromo-4′-chloroacetophenone , ≥98.0%(GC) , 536-38-9
Synonym(s):
ω-Bromo-4-chloroacetophenone;4-Chlorophenacyl bromide
CAS NO.:536-38-9
Empirical Formula: C8H6BrClO
Molecular Weight: 233.49
MDL number: MFCD00000625
EINECS: 208-631-5
| Pack Size | Price | Stock | Quantity |
| 5G | RMB55.20 | In Stock |
|
| 25G | RMB183.20 | In Stock |
|
| 100G | RMB495.20 | In Stock |
|
| 500G | RMB2079.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 93-96 °C(lit.) |
| Boiling point: | 186°C (rough estimate) |
| Density | 1.5624 (rough estimate) |
| refractive index | 1.5963 (estimate) |
| storage temp. | Inert atmosphere,2-8°C |
| solubility | soluble in Methanol |
| form | Crystals |
| color | White to pale yellow |
| Water Solubility | Insoluble in water. |
| Sensitive | Lachrymatory |
| Merck | 14,2153 |
| BRN | 607603 |
| InChI | InChI=1S/C8H6BrClO/c9-5-8(11)6-1-3-7(10)4-2-6/h1-4H,5H2 |
| InChIKey | FLAYZKKEOIAALB-UHFFFAOYSA-N |
| SMILES | C(=O)(C1=CC=C(Cl)C=C1)CBr |
| CAS DataBase Reference | 536-38-9(CAS DataBase Reference) |
| EPA Substance Registry System | Ethanone, 2-bromo-1-(4-chlorophenyl)- (536-38-9) |
Description and Uses
In the preparation of quaternary salts of methenamine and of chlorophenol glyoximes.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P261-P264-P270-P301+P312-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | Eyeshields, Faceshields, Gloves, type P3 (EN 143) respirator cartridges |
| Hazard Codes | C |
| Risk Statements | 34-22-36 |
| Safety Statements | 26-36/37/39-45-27 |
| RIDADR | UN 3261 8/PG 2 |
| WGK Germany | 2 |
| RTECS | AM5978800 |
| F | 19 |
| Hazard Note | Corrosive/Lachrymatory/Keep Cold |
| TSCA | TSCA listed |
| HazardClass | 8 |
| PackingGroup | III |
| HS Code | 29147000 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| Toxicity | LD50 orally in mice: >2000 mg/kg (Dat-Xuong) |






