A1550512
Bis(2,2,2-trifluoroethyl) Phosphite , >94.0%(GC) , 92466-70-1
Synonym(s):
Phosphonic acid bis(2,2,2-trifluoroethyl) ester
| Pack Size | Price | Stock | Quantity |
| 1G | RMB87.20 | In Stock |
|
| 5G | RMB300.80 | In Stock |
|
| 25G | RMB1119.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 43-44 °C/2 mmHg (lit.) |
| Density | 1.545 g/mL at 25 °C (lit.) |
| refractive index | n |
| Flash point: | 169 °F |
| form | Liquid |
| color | Colorless to Almost colorless |
| InChI | 1S/C4H5F6O3P/c5-3(6,7)1-12-14(11)13-2-4(8,9)10/h14H,1-2H2 |
| InChIKey | NYQKUVUXMIHXEA-UHFFFAOYSA-N |
| SMILES | FC(F)(F)CO[PH](=O)OCC(F)(F)F |
Description and Uses
Bis(2,2,2-trifluoroethyl) phosphite was used in the synthesis of bis(2,2,2-trifluoroethyl phosphorochloridate. It was also employed as reagent for the synthesis of mono- and diesters of phosphorous acid.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 23-26-28-36 |
| WGK Germany | 3 |
| HS Code | 2920.90.5100 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |




![ETHYL 2-[BIS(2,2,2-TRIFLUOROETHYL)PHOSPHONO] PROPIONATE](https://img.chemicalbook.com/CAS/GIF/107905-52-2.gif)
![Ethyl [bis(2,2,2-<WBR>trifluoroethoxy)<WBR>phosphinyl]<WBR>acetate](https://img.chemicalbook.com/CAS/GIF/124755-24-4.gif)

