A7977512
Tris(2,2,2-trifluoroethyl) Phosphate , >96.0%(GC) , 358-63-4
| Pack Size | Price | Stock | Quantity |
| 1g | RMB23.20 | In Stock |
|
| 5G | RMB24.00 | In Stock |
|
| 25G | RMB85.60 | In Stock |
|
| 100g | RMB316.80 | In Stock |
|
| 500g | RMB1562.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | -22℃ |
| Boiling point: | 186-189℃ |
| Density | 1.56 |
| refractive index | 1.3200 (20℃) |
| storage temp. | Storage temp. 2-8°C |
| form | clear liquid |
| color | Colorless to Almost colorless |
| InChI | InChI=1S/C6H6F9O4P/c7-4(8,9)1-17-20(16,18-2-5(10,11)12)19-3-6(13,14)15/h1-3H2 |
| InChIKey | ZMQDTYVODWKHNT-UHFFFAOYSA-N |
| SMILES | P(OCC(F)(F)F)(OCC(F)(F)F)(OCC(F)(F)F)=O |
Description and Uses
Tris(2,2,2-trifluoroethyl)phosphate is a useful chemical used as nonflammable electrolytes for Li-ion batteries.
Safety
| Symbol(GHS) |   GHS07,GHS02 |
| Signal word | Warning |
| Hazard statements | H226-H319-H315 |
| Precautionary statements | P264-P280-P305+P351+P338-P337+P313P-P264-P280-P302+P352-P321-P332+P313-P362 |
| Hazard Codes | Xi |
| RIDADR | 3272 |
| HazardClass | 3 |
| PackingGroup | III |
| HS Code | 29199000 |
