A1591312
β-Butyrolactone , >95.0%(GC) , 3068-88-0
Synonym(s):
β-Methyl-β-propiolactone;3-Hydroxybutyric acid β-lactone;4-Methyl-2-oxetanone;beta-Butyrolactone
CAS NO.：3068-88-0
Empirical Formula: C4H6O2
Molecular Weight: 86.09
MDL number: MFCD00005170
EINECS: 221-330-3
| Pack Size | Price | Stock | Quantity |
| 5G | RMB215.20 | In Stock |
|
| 100g | RMB2639.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | −43.5 °C(lit.) |
| Boiling point: | 71-73 °C29 mm Hg(lit.) |
| Density | 1.056 g/mL at 25 °C(lit.) |
| refractive index | n |
| Flash point: | 140 °F |
| storage temp. | Storage temp. 2-8°C |
| solubility | Soluble[in water] |
| color | Colorless to Almost colorless |
| Water Solubility | 132.7g/L(18 ºC) |
| Stability: | Stable. Incompatible with strong bases, strong oxidizing agents. Flammable. |
| InChI | InChI=1S/C4H6O2/c1-3-2-4(5)6-3/h3H,2H2,1H3 |
| InChIKey | GSCLMSFRWBPUSK-UHFFFAOYSA-N |
| SMILES | O1C(C)CC1=O |
| CAS DataBase Reference | 3068-88-0(CAS DataBase Reference) |
| IARC | 2B (Vol. 11, Sup 7, 71) 1999 |
| EPA Substance Registry System | .beta.-Butyrolactone (3068-88-0) |
Description and Uses
β-Butyrolactone was used in the preparation of (3- O -[oligo-(3-hydroxybutyrate ester)] fluorescein, fluorescein derivative of poly(3-hydroxybutyrate) via anionic polymerization.
Safety
| Symbol(GHS) |    GHS02,GHS07,GHS08 |
| Signal word | Warning |
| Hazard statements | H226-H315-H319-H351 |
| Precautionary statements | P201-P210-P302+P352-P305+P351+P338-P308+P313 |
| Hazard Codes | Xn |
| Risk Statements | 36/38-40 |
| Safety Statements | 26-36 |
| RIDADR | UN 1993 3/PG 3 |
| WGK Germany | 3 |
| RTECS | RQ8050000 |
| HS Code | 2932.20.5050 |
| HazardClass | 3.2 |
| PackingGroup | III |
