A1682512
1-<WBR>Boc-<WBR>4-<WBR>(4-<WBR>formylphenyl)<WBR>piperazine , 97% , 197638-83-8
Synonym(s):
tert-Butyl 4-(4′-formylphenyl)piperazine-1-carboxylate;4-(N-Boc-piperazin-1-yl)benzaldehyde
CAS NO.:197638-83-8
Empirical Formula: C16H22N2O3
Molecular Weight: 290.36
MDL number: MFCD05864663
EINECS: 201-215-5
| Pack Size | Price | Stock | Quantity |
| 250mg | RMB27.20 | In Stock |
|
| 1G | RMB72.80 | In Stock |
|
| 5G | RMB224.80 | In Stock |
|
| 25g | RMB1038.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 118-121 °C (lit.) |
| Boiling point: | 441.4±40.0 °C(Predicted) |
| Density | 1.154±0.06 g/cm3(Predicted) |
| storage temp. | Keep in dark place,Sealed in dry,Room Temperature |
| form | solid |
| pka | 2.45±0.10(Predicted) |
| Appearance | Light yellow to yellow Solid |
| Sensitive | Air Sensitive |
| InChI | InChI=1S/C16H22N2O3/c1-16(2,3)21-15(20)18-10-8-17(9-11-18)14-6-4-13(12-19)5-7-14/h4-7,12H,8-11H2,1-3H3 |
| InChIKey | KHORERZDMJTBMR-UHFFFAOYSA-N |
| SMILES | N1(C(OC(C)(C)C)=O)CCN(C2=CC=C(C=O)C=C2)CC1 |
Safety
| Symbol(GHS) | ![]() GHS06 |
| Signal word | Danger |
| Hazard statements | H301-H317 |
| Precautionary statements | P261-P280g-P301+P310a-P321-P405-P501a-P280-P301+P310 |
| PPE | Eyeshields, Faceshields, Gloves, type P2 (EN 143) respirator cartridges |
| Hazard Codes | T |
| Risk Statements | 25-43 |
| Safety Statements | 36/37-45 |
| RIDADR | UN 2811 6.1/PG 3 |
| WGK Germany | 3 |
| Hazard Note | Irritant |
| HazardClass | 6.1 |
| HS Code | 2933599590 |
| Storage Class | 6.1D - Non-combustible acute toxic Cat.3 toxic hazardous materials or hazardous materials causing chronic effects |
| Hazard Classifications | Acute Tox. 3 Oral Skin Sens. 1 |
| Limited Quantities | 5.0 L (1.3 gallons) (liquid) or 5.0 kg (11 lbs) (solid) |
| Excepted Quantities | Max Inner Pack (30g or 30ml) and Max Outer Pack (1Kg or 1L) |






