A1712312
Boc-<SC>DL</SC>-Val-OH , 98% , 54895-12-4
Synonym(s):
Boc-DL -valine
| Pack Size | Price | Stock | Quantity |
| 5G | RMB40.00 | In Stock |
|
| 10G | RMB60.00 | In Stock |
|
| 25g | RMB130.40 | In Stock |
|
| 100g | RMB378.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 112-114℃ |
| Boiling point: | 341.8±25.0 °C(Predicted) |
| Density | 1.079±0.06 g/cm3(Predicted) |
| storage temp. | Keep in dark place,Sealed in dry,Room Temperature |
| pka | 4.01±0.10(Predicted) |
| form | Solid |
| color | White to off-white |
| BRN | 9196510 |
| InChI | InChI=1S/C10H19NO4/c1-6(2)7(8(12)13)11-9(14)15-10(3,4)5/h6-7H,1-5H3,(H,11,14)(H,12,13)/t7-/m0/s1 |
| InChIKey | SZXBQTSZISFIAO-ZETCQYMHSA-N |
| SMILES | C(O)(=O)[C@H](C(C)C)NC(OC(C)(C)C)=O |
Description and Uses
2-(tert-Butoxycarbonylamino)-3-methylbutanoic Acid is a useful synthesis intermediate used in the preparation of amino acid ester homocamptothecin analogs that exhibits anti-tumor properties.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P261-P305+P351+P338 |
| Safety Statements | 24/25 |
| WGK Germany | 3 |
| HS Code | 29241990 |
