A2277212
2-Chloro-5-(trifluoromethyl)benzeneboronic acid , 96% , 182344-18-9
Synonym(s):
2-Chloro-5-(trifluoromethyl)benzeneboronic acid
CAS NO.：182344-18-9
Empirical Formula: C7H5BClF3O2
Molecular Weight: 224.37
MDL number: MFCD00797335
| Pack Size | Price | Stock | Quantity |
| 1G | RMB84.80 | In Stock |
|
| 5G | RMB299.20 | In Stock |
|
| 25G | RMB1080.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 108 °C |
| Boiling point: | 303.2±52.0 °C(Predicted) |
| Density | 1.49±0.1 g/cm3(Predicted) |
| storage temp. | under inert gas (nitrogen or Argon) at 2-8°C |
| solubility | soluble in Methanol |
| form | powder to crystal |
| pka | 7.26±0.58(Predicted) |
| color | White to Almost white |
| InChI | InChI=1S/C7H5BClF3O2/c9-6-2-1-4(7(10,11)12)3-5(6)8(13)14/h1-3,13-14H |
| InChIKey | YVMXEHZEYONARR-UHFFFAOYSA-N |
| SMILES | B(C1=CC(C(F)(F)F)=CC=C1Cl)(O)O |
| CAS DataBase Reference | 182344-18-9(CAS DataBase Reference) |
Description and Uses
suzuki reaction
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P305+P351+P338-P280a-P304+P340-P405-P501a-P264-P280-P302+P352+P332+P313+P362+P364-P305+P351+P338+P337+P313 |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36-37/39 |
| RIDADR | UN 3335 |
| WGK Germany | 3 |
| HazardClass | IRRITANT |
| HS Code | 29319090 |
