A2317412
2-Chloro-4-cyanopyridine , 97% , 33252-30-1
Synonym(s):
2-Chloro-4-cyanopyridine
CAS NO.:33252-30-1
Empirical Formula: C6H3ClN2
Molecular Weight: 138.55
MDL number: MFCD00174318
EINECS: 608-852-0
| Pack Size | Price | Stock | Quantity |
| 5G | RMB47.20 | In Stock |
|
| 25G | RMB111.20 | In Stock |
|
| 100G | RMB391.20 | In Stock |
|
| 250g | RMB952.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 69-73 °C(lit.) |
| Boiling point: | 104-106°C 15mm |
| Density | 1.33±0.1 g/cm3(Predicted) |
| Flash point: | 104-106°C/15mm |
| storage temp. | Keep in dark place,Sealed in dry,Room Temperature |
| solubility | soluble in Methanol |
| form | powder to crystal |
| pka | -1.60±0.10(Predicted) |
| color | White to Almost white |
| BRN | 113927 |
| InChI | InChI=1S/C6H3ClN2/c7-6-3-5(4-8)1-2-9-6/h1-3H |
| InChIKey | QRXBTPFMCTXCRD-UHFFFAOYSA-N |
| SMILES | C1(Cl)=NC=CC(C#N)=C1 |
| CAS DataBase Reference | 33252-30-1(CAS DataBase Reference) |
Description and Uses
2-Chloro-4-cyanopyridine is an intermediate used to prepare pyrrolopyridine inhibitors of mitogen-activated protein kinase-activated protein kinase 2 (MK-2). It is also used to synthesize pyridinyl-tetrazoles as scaffold to identify matrix MMP-13 inhibitors for treatment of osteoarthritis.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | Eyeshields, Gloves, type ABEK (EN14387) respirator filter |
| Hazard Codes | Xi,Xn |
| Risk Statements | 36/37/38-20/21/22 |
| Safety Statements | 26-36-36/37/39-36/37 |
| RIDADR | 3276 |
| WGK Germany | 3 |
| Hazard Note | Irritant |
| HazardClass | 6.1 |
| PackingGroup | III |
| HS Code | 29333990 |
| Storage Class | 10 - Combustible liquids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |







