A2342112
Cadmium acetylacetonate , 98% , 14689-45-3
Synonym(s):
2,4-Pentanedione cadmium derivative;Cd(acac)2
CAS NO.:14689-45-3
Empirical Formula: C10H14CdO4
Molecular Weight: 310.63
MDL number: MFCD08272318
EINECS: 238-730-9
| Pack Size | Price | Stock | Quantity |
| 5G | RMB79.20 | In Stock |
|
| 25G | RMB319.20 | In Stock |
|
| 100G | RMB1039.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 209-214 °C(lit.) |
| form | Powder |
| color | white |
| Water Solubility | Soluble in water 3.9 g/L. |
| Hydrolytic Sensitivity | 4: no reaction with water under neutral conditions |
| Exposure limits | ACGIH: TWA 0.01 mg/m3; TWA 0.002 mg/m3 NIOSH: IDLH 9 mg/m3 |
| InChI | InChI=1S/2C5H8O2.Cd/c2*1-4(6)3-5(2)7;/h2*3,6H,1-2H3;/q;;+2/p-2/b2*4-3-; |
| InChIKey | JXULEGTWCQDLTM-FDGPNNRMSA-L |
| SMILES | O([Cd]O/C(/C)=C\C(=O)C)/C(/C)=C\C(=O)C |
Description and Uses
Cadmium 2,4-pentanedionate is used as a pharmaceutical intermediate.
Safety
| Symbol(GHS) | ![]() ![]() ![]() GHS07,GHS08,GHS09 |
| Signal word | Warning |
| Hazard statements | H302+H312+H332-H351-H361d-H373-H410 |
| Precautionary statements | P273-P280-P301+P312-P302+P352+P312-P304+P340+P312-P308+P313 |
| target organs | Kidney,Bone |
| Hazard Codes | Xn,N |
| Risk Statements | 20/21/22-50/53 |
| Safety Statements | 60-61 |
| RIDADR | UN 2570 6.1/PG 2 |
| WGK Germany | 3 |
| RTECS | EV0260000 |
| TSCA | No |
| HazardClass | 6.1 |
| PackingGroup | III |
| Storage Class | 6.1A - Combustible acute toxic Cat. 1 and 2 very toxic hazardous materials |
| Hazard Classifications | Acute Tox. 4 Dermal Acute Tox. 4 Inhalation Acute Tox. 4 Oral Aquatic Acute 1 Aquatic Chronic 1 Carc. 2 Repr. 2 STOT RE 2 |









