A2251812
Calcium acetylacetonate , 98% , 19372-44-2
CAS NO.：19372-44-2
Empirical Formula: C10H14CaO4
Molecular Weight: 238.29
MDL number: MFCD00013486
EINECS: 243-001-3
| Pack Size | Price | Stock | Quantity |
| 25g | RMB23.20 | In Stock |
|
| 50G | RMB26.40 | In Stock |
|
| 250G | RMB68.00 | In Stock |
|
| 1kg | RMB223.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 175°C (dec.) |
| Density | 1.371[at 20℃] |
| vapor pressure | 0.01Pa at 25℃ |
| storage temp. | RT, stored under nitrogen |
| form | Powder |
| color | white |
| Water Solubility | 11.9 g/l |
| Hydrolytic Sensitivity | 4: no reaction with water under neutral conditions |
| InChI | InChI=1S/C5H7O2.Ca/c1-4(6)3-5(2)7;/h3H,1-2H3;/q-1;+2 |
| InChIKey | CVKLJNZPNLIMCK-UHFFFAOYSA-N |
| SMILES | [CH-](C(=O)C)C(=O)C.[Ca+2] |
| LogP | -1.1 at 22℃ |
| CAS DataBase Reference | 19372-44-2(CAS DataBase Reference) |
| EPA Substance Registry System | 2,4-Pentanedione, ion(1-), calcium (19372-44-2) |
Description and Uses
calcium acetylacetonate is the most ordinary heat stabilizer for halogenated polymers such as PVC. It can also be used as catalyst, cross-linking agent, resin hardening accelerant, resin and rubber additive, etc.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P261-P305+P351+P338 |
| Hazard Codes | Xn |
| Risk Statements | 36/37/38-63-22 |
| Safety Statements | 26-36/37/39 |
| TSCA | Yes |
| HS Code | 29141900 |
| Toxicity | oral rat, LD50: 1,250 mg/kg |
