A2412212
2-Chloro-3-iodopyridine , 98% , 78607-36-0
CAS NO.:78607-36-0
Empirical Formula: C5H3ClIN
Molecular Weight: 239.44
MDL number: MFCD00661298
EINECS: 675-002-3
| Pack Size | Price | Stock | Quantity |
| 1G | RMB24.00 | In Stock |
|
| 5G | RMB84.00 | In Stock |
|
| 25G | RMB259.20 | In Stock |
|
| 100G | RMB791.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 90-95 °C |
| Boiling point: | 261.2±20.0 °C(Predicted) |
| Density | 2.052±0.06 g/cm3(Predicted) |
| storage temp. | Keep in dark place,Sealed in dry,Room Temperature |
| solubility | Chloroform, Ethyl Acetate |
| form | Crystalline Powder |
| pka | -0.70±0.10(Predicted) |
| color | Cream yellow to salmon |
| Sensitive | Light Sensitive |
| BRN | 4243304 |
| InChI | InChI=1S/C5H3ClIN/c6-5-4(7)2-1-3-8-5/h1-3H |
| InChIKey | OHWSWGXNZDSHLM-UHFFFAOYSA-N |
| SMILES | C1(Cl)=NC=CC=C1I |
| CAS DataBase Reference | 78607-36-0(CAS DataBase Reference) |
Description and Uses
2-Chloro-3-iodopyridine (cas# 78607-36-0) is a compound useful in organic synthesis.
Safety
| Symbol(GHS) | ![]() ![]() ![]() GHS05,GHS07,GHS06 |
| Signal word | Danger |
| Hazard statements | H302-H318-H301-H311-H315-H319-H332-H335 |
| Precautionary statements | P280-P305+P351+P338-P261-P301+P310a-P405-P501a |
| Hazard Codes | Xn,Xi |
| Risk Statements | 36/37/38-20/22-41-22 |
| Safety Statements | 36/37/39-26-22-36-39-37 |
| WGK Germany | 3 |
| Hazard Note | Irritant/Light Sensitive |
| HazardClass | IRRITANT |
| HS Code | 29333990 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral Eye Dam. 1 |







