A2424412
4'-Chloro-3'-nitroacetophenone , 98% , 5465-65-6
CAS NO.：5465-65-6
Empirical Formula: C8H6ClNO3
Molecular Weight: 199.59
MDL number: MFCD00007083
EINECS: 226-769-4
| Pack Size | Price | Stock | Quantity |
| 5G | RMB85.60 | In Stock |
|
| 25G | RMB305.60 | In Stock |
|
| 100G | RMB1092.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 99-101 °C(lit.) |
| Boiling point: | 160°C (rough estimate) |
| Density | 1.4125 (rough estimate) |
| refractive index | 1.6000 (estimate) |
| storage temp. | Store at room temperature |
| form | powder to crystal |
| color | White to Light yellow to Green |
| BRN | 1640627 |
| InChI | 1S/C8H6ClNO3/c1-5(11)6-2-3-7(9)8(4-6)10(12)13/h2-4H,1H3 |
| InChIKey | YEVPHFIFGUWSMG-UHFFFAOYSA-N |
| SMILES | CC(=O)c1ccc(Cl)c(c1)[N+]([O-])=O |
| CAS DataBase Reference | 5465-65-6(CAS DataBase Reference) |
Description and Uses
4′-Chloro-3′-nitroacetophenone was used to prepare starting reagent for the synthesis of 6- and 7-acetyl-3-methyl-2-quinoxalinecarboxamide1,4-dioxides.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36-37/39 |
| WGK Germany | 3 |
| Hazard Note | Irritant |
| HS Code | 29147000 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
