A2433212
3-Chloro-2-fluorobenzoic Acid , 98% , 161957-55-7
CAS NO.:161957-55-7
Empirical Formula: C7H4ClFO2
Molecular Weight: 174.56
MDL number: MFCD00042506
EINECS: 630-303-9
| Pack Size | Price | Stock | Quantity |
| 1G | RMB24.00 | In Stock |
|
| 5G | RMB60.00 | In Stock |
|
| 25G | RMB212.00 | In Stock |
|
| 100G | RMB646.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 177-180 °C (lit.) |
| Boiling point: | 278.9±20.0 °C(Predicted) |
| Density | 1.477±0.06 g/cm3(Predicted) |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | soluble in Methanol |
| form | powder to crystal |
| pka | 2.90±0.10(Predicted) |
| color | White to Light yellow to Light red |
| BRN | 7127637 |
| InChI | InChI=1S/C7H4ClFO2/c8-5-3-1-2-4(6(5)9)7(10)11/h1-3H,(H,10,11) |
| InChIKey | FCSSYEWURMTUSM-UHFFFAOYSA-N |
| SMILES | C(O)(=O)C1=CC=CC(Cl)=C1F |
| CAS DataBase Reference | 161957-55-7(CAS DataBase Reference) |
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P280a-P304+P340-P305+P351+P338-P405-P501a-P264-P280-P302+P352+P332+P313+P362+P364-P305+P351+P338+P337+P313 |
| PPE | Eyeshields, Gloves, type N95 (US) |
| Hazard Codes | Xi,Xn |
| Risk Statements | 20/21/22-36/37/38 |
| Safety Statements | 22-24/25-36-26 |
| WGK Germany | 3 |
| TSCA | TSCA listed |
| HazardClass | IRRITANT |
| HS Code | 29163990 |
| Storage Class | 11 - Combustible Solids |







