A2488312
4-Cyano-4-(phenylcarbonothioylthio)pentanoic Acid , >97%(HPLC) , 201611-92-9
Synonym(s):
4-Cyano-4-(thiobenzoylthio)pentanoic acid
CAS NO.:201611-92-9
Empirical Formula: C13H13NO2S2
Molecular Weight: 279.38
MDL number: MFCD10698690
| Pack Size | Price | Stock | Quantity |
| 200mg | RMB143.20 | In Stock |
|
| 500mg | RMB319.20 | In Stock |
|
| 1G | RMB500.00 | In Stock |
|
| 5G | RMB1945.60 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 94-98°C |
| Boiling point: | 473.0±55.0 °C(Predicted) |
| Density | 1.309±0.06 g/cm3(Predicted) |
| storage temp. | 2-8°C |
| solubility | Chloroform (Sparingly), Ethyl Acetate (Very Slightly), DMSO (Slightly), Methanol |
| pka | 4.07±0.10(Predicted) |
| form | Powder |
| color | pink |
| Sensitive | light sensitive, store cold |
| InChI | InChI=1S/C13H13NO2S2/c1-13(9-14,8-7-11(15)16)18-12(17)10-5-3-2-4-6-10/h2-6H,7-8H2,1H3,(H,15,16) |
| InChIKey | YNKQCPNHMVAWHN-UHFFFAOYSA-N |
| SMILES | C(O)(=O)CCC(C#N)(SC(C1=CC=CC=C1)=S)C |
Description and Uses
4-Cyano-4-(phenylcarbonothioylthio)pentanoic acid is a RAFT agent for controlled radical polymerization; especially suited for the polymerization of methacrylate and methacrylamide monomers. Chain Transfer Agent (CTA).






