A2604612
5-Chloro-2,3-diphenylpyrazine , >98.0%(GC) , 41270-66-0
CAS NO.:41270-66-0
Empirical Formula: C16H11ClN2
Molecular Weight: 266.72
MDL number: MFCD00234892
EINECS: 813-797-2
| Pack Size | Price | Stock | Quantity |
| 250mg | RMB128.00 | In Stock |
|
| 1G | RMB312.00 | In Stock |
|
| 5G | RMB966.40 | In Stock |
|
| 25g | RMB3156.00 | In Stock |
|
| 100g | RMB7999.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 126-128℃ (methanol ) |
| Boiling point: | 145°C/0.001mmHg(lit.) |
| Density | 1+-.0.06 g/cm3(Predicted) |
| storage temp. | 2-8°C, sealed storage, away from moisture |
| form | powder to crystal |
| pka | -2.16±0.10(Predicted) |
| color | White to Orange to Green |
| InChI | InChI=1S/C16H11ClN2/c17-14-11-18-15(12-7-3-1-4-8-12)16(19-14)13-9-5-2-6-10-13/h1-11H |
| InChIKey | VUGNCPVAXWZTOL-UHFFFAOYSA-N |
| SMILES | C1(C2=CC=CC=C2)=NC=C(Cl)N=C1C1=CC=CC=C1 |
| CAS DataBase Reference | 41270-66-0 |
Description and Uses
2-Chloro-5,6-diphenylpyrazine is a diphenylpyrazine derivative used in a study to determine a novel class of prostacyclin receptor agonists.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H413 |
| Precautionary statements | P501-P273-P264-P280-P302+P352-P337+P313-P305+P351+P338-P362+P364-P332+P313 |
| HS Code | 2933.99.5300 |



![Acetamide, 2-[4-[(5,6-diphenyl-2-pyrazinyl)(1-methylethyl)amino]butoxy]-](https://img.chemicalbook.com/CAS/20210111/GIF/475086-28-3.gif)


![( 2-{4-[N-(5,6-diphenylpyrazin-2-yl)-N-isopropylamino]butyloxy}acetic acid tert-butylester )](https://img.chemicalbook.com/CAS/20180702/GIF/475084-96-9.gif)
