A5077112
4-(Isopropylamino)butanol , ≥98.0% , 42042-71-7
CAS NO.:42042-71-7
Empirical Formula: C7H17NO
Molecular Weight: 131.22
MDL number: MFCD14708173
EINECS: 678-583-1
| Pack Size | Price | Stock | Quantity |
| 1G | RMB44.80 | In Stock |
|
| 5G | RMB131.20 | In Stock |
|
| 10g | RMB223.20 | In Stock |
|
| 25g | RMB513.60 | In Stock |
|
| 100g | RMB1163.20 | In Stock |
|
| 500g | RMB4639.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 85°C/1mmHg(lit.) |
| Density | 0.889 g/cm3 |
| refractive index | 1.4480-1.4520 |
| storage temp. | under inert gas (nitrogen or Argon) at 2–8 °C |
| form | clear liquid |
| pka | 15.13±0.10(Predicted) |
| color | Colorless to Almost colorless |
| InChI | InChI=1S/C7H17NO/c1-7(2)8-5-3-4-6-9/h7-9H,3-6H2,1-2H3 |
| InChIKey | IPLWOCGPIGUXOR-UHFFFAOYSA-N |
| SMILES | C(O)CCCNC(C)C |
Description and Uses
4-(Isopropylamino)butanol is used as a solvent for paints, varnishes, and lacquers.
Safety
| Symbol(GHS) | ![]() ![]() GHS02,GHS07 |
| Signal word | Warning |
| Hazard statements | H226-H315-H319 |
| Precautionary statements | P210-P233-P240-P241+P242+P243-P264-P280-P302+P352+P332+P313+P362+P364-P305+P351+P338+P337+P313-P370+P378-P403+P235-P501 |
| RIDADR | 1993 |
| HazardClass | 3 |
| PackingGroup | III |
| HS Code | 2922190090 |






![Acetamide, 2-[4-[(5,6-diphenyl-2-pyrazinyl)(1-methylethyl)amino]butoxy]-](https://img.chemicalbook.com/CAS/20210111/GIF/475086-28-3.gif)

