BD0120348
4-((5,6-Diphenylpyrazin-2-yl)(isopropyl)amino)butan-1-ol , 98% , 475086-75-0
CAS NO.:475086-75-0
Empirical Formula: C23H27N3O
Molecular Weight: 361.48
MDL number:
EINECS: 813-799-3
| Pack Size | Price | Stock | Quantity |
| 250mg | RMB288.80 | In Stock |
|
| 1g | RMB620.00 | In Stock |
|
| 5g | RMB1864.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 68 - 71°C |
| Boiling point: | 514.4±50.0 °C(Predicted) |
| Density | 1.112±0.06 g/cm3(Predicted) |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | Chloroform (Slightly), DMSO (Slightly) |
| form | Solid |
| pka | 15.05±0.10(Predicted) |
| color | Pale Yellow to Light Yellow |
| InChI | InChI=1S/C23H27N3O/c1-18(2)26(15-9-10-16-27)21-17-24-22(19-11-5-3-6-12-19)23(25-21)20-13-7-4-8-14-20/h3-8,11-14,17-18,27H,9-10,15-16H2,1-2H3 |
| InChIKey | PKBSUZWFQXNCSI-UHFFFAOYSA-N |
| SMILES | C(O)CCCN(C1=NC(C2=CC=CC=C2)=C(C2=CC=CC=C2)N=C1)C(C)C |
Description and Uses
4-[(5,6-Diphenyl-2-pyrazinyl)(1-methylethyl)amino]-1-butanol is a diphenylpyrazine derivative which belongs to a class of prostacyclin receptor agonists. It is an impurity of Selexipag (S253150) that is a potential drug for the treatment of various vascular disorders such as pulmonary arterial hypertension and arteriosclerosis obliterans.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P261-P280-P301+P312-P302+P352-P305+P351+P338 |



![Acetamide, 2-[4-[(5,6-diphenyl-2-pyrazinyl)(1-methylethyl)amino]butoxy]-](https://img.chemicalbook.com/CAS/20210111/GIF/475086-28-3.gif)


![( 2-{4-[N-(5,6-diphenylpyrazin-2-yl)-N-isopropylamino]butyloxy}acetic acid tert-butylester )](https://img.chemicalbook.com/CAS/20180702/GIF/475084-96-9.gif)
