A2611012
5-Chloro-2-hydroxybenzophenone , >98.0% , 85-19-8
CAS NO.:85-19-8
Empirical Formula: C13H9ClO2
Molecular Weight: 232.66
MDL number: MFCD00020134
EINECS: 201-592-5
| Pack Size | Price | Stock | Quantity |
| 1G | RMB62.40 | In Stock |
|
| 5G | RMB191.20 | In Stock |
|
| 25G | RMB599.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 96-98 °C(lit.) |
| Boiling point: | 147-149 °C(Press: 0.3 Torr) |
| Density | 1.307±0.06 g/cm3(Predicted) |
| storage temp. | Inert atmosphere,Room Temperature |
| solubility | Chloroform (Slightly), Methanol (Slightly) |
| pka | 7.49±0.43(Predicted) |
| form | Solid |
| color | Pale Yellow to Brown |
| λmax | 430nm(CH3CN)(lit.) |
| Cosmetics Ingredients Functions | UV ABSORBER |
| InChI | 1S/C13H9ClO2/c14-10-6-7-12(15)11(8-10)13(16)9-4-2-1-3-5-9/h1-8,15H |
| InChIKey | OMWSZDODENFLSV-UHFFFAOYSA-N |
| SMILES | Oc1ccc(Cl)cc1C(=O)c2ccccc2 |
| LogP | 4.620 (est) |
| CAS DataBase Reference | 85-19-8(CAS DataBase Reference) |
| NIST Chemistry Reference | 5-Chloro-2-hydroxybenzophenone(85-19-8) |
Description and Uses
5-Chloro-2-hydroxybenzophenone is a type of UV filter used in the protection of surfaces sensitive to radiation. Applied in sunscreens and camera lens filters. Potential antibacterial agent.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-37/39 |
| WGK Germany | 3 |
| HS Code | 29147000 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| Hazardous Substances Data | 85-19-8(Hazardous Substances Data) |






