A2832412
5-Chloro-2,4-difluorobenzenesulfonyl chloride , 98% , 13656-57-0
CAS NO.：13656-57-0
Empirical Formula: C6H2Cl2F2O2S
Molecular Weight: 247.05
MDL number: MFCD01940426
| Pack Size | Price | Stock | Quantity |
| 1g | RMB23.20 | In Stock |
|
| 5G | RMB61.60 | In Stock |
|
| 25G | RMB264.80 | In Stock |
|
| 100G | RMB947.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 44-45° |
| Boiling point: | 289℃ |
| Density | 1.686 |
| Flash point: | 129℃ |
| storage temp. | under inert gas (nitrogen or Argon) at 2-8°C |
| form | crystalline solid |
| color | White to off-white |
| InChI | InChI=1S/C6H2Cl2F2O2S/c7-3-1-6(13(8,11)12)5(10)2-4(3)9/h1-2H |
| InChIKey | XMNXVDULKLCZFG-UHFFFAOYSA-N |
| SMILES | C1(S(Cl)(=O)=O)=CC(Cl)=C(F)C=C1F |
| CAS DataBase Reference | 13656-57-0(CAS DataBase Reference) |
Safety
| Symbol(GHS) |  GHS05 |
| Signal word | Danger |
| Hazard statements | H314 |
| Precautionary statements | P260-P264-P280-P301+P330+P331-P303+P361+P353-P363-P304+P340-P310-P321-P305+P351+P338-P405-P501 |
| Hazard Codes | C |
| Risk Statements | 34 |
| Safety Statements | 26-36/37/39 |
| RIDADR | 3261 |
| WGK Germany | WGK 3 |
| HazardClass | CORROSIVE |
| HS Code | 2904990090 |
| Storage Class | 11 - Combustible Solids |
| Limited Quantities | 5.0 L (1.3 gallons) (liquid) or 5.0 kg (11 lbs) (solid) |
| Excepted Quantities | Max Inner Pack (30g or 30ml) and Max Outer Pack (1Kg or 1L) |
