A2963012
2-Chloro-N-(2-ethyl-6-methylphenyl)acetamide , 97% , 32428-71-0
| Pack Size | Price | Stock | Quantity |
| 1G | RMB59.20 | In Stock |
|
| 5G | RMB186.40 | In Stock |
|
| 25g | RMB599.20 | In Stock |
|
| 100g | RMB1688.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 120-121 °C(Solv: ethanol, 50% (64-17-5)) |
| Boiling point: | 343.1±37.0 °C(Predicted) |
| Density | 1.156±0.06 g/cm3(Predicted) |
| storage temp. | under inert gas (nitrogen or Argon) at 2-8°C |
| solubility | Chloroform (Slightly), Methanol (Slightly, Heated) |
| form | Solid |
| pka | 12.91±0.70(Predicted) |
| color | Off-White to Pale Red |
| InChI | InChI=1S/C11H14ClNO/c1-3-9-6-4-5-8(2)11(9)13-10(14)7-12/h4-6H,3,7H2,1-2H3,(H,13,14) |
| InChIKey | SMINYPCTNJDYGK-UHFFFAOYSA-N |
| SMILES | C(NC1=C(C)C=CC=C1CC)(=O)CCl |
| CAS DataBase Reference | 32428-71-0 |
| EPA Substance Registry System | Acetamide, 2-chloro-N-(2-ethyl-6-methylphenyl)- (32428-71-0) |
Description and Uses
2-Ethyl-6-methyl-2-chloroacetanilide is an intermediate of the herbicides acetochlor, metolachlor and metolachlor.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H319 |
| Precautionary statements | P264-P280-P305+P351+P338-P337+P313P |






