A3163312
Daidzin , Analysis of standard products, ≥98% , 552-66-9
Synonym(s):
4′,7-Dihydroxyisoflavone 7-glucoside;Daidzein 7-glucoside;Daidzein-7-O-β-D -glucopyranoside;Daidzin
| Pack Size | Price | Stock | Quantity |
| 5mg | RMB120.00 | In Stock |
|
| 10MG | RMB255.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 234-236°C |
| alpha | -24 º (C=0.1g/100ml,dimethylsulfoxide) |
| Boiling point: | 727.6±60.0 °C(Predicted) |
| Density | 1.572±0.06 g/cm3(Predicted) |
| storage temp. | -20°C |
| solubility | DMSO (Slightly, Sonicated), Methanol (Slightly, Heated) |
| pka | 9.65±0.30(Predicted) |
| form | Solid |
| color | White to Off-White |
| λmax | 297nm(lit.) |
| BRN | 59741 |
| InChIKey | KYQZWONCHDNPDP-LKLLPNDVNA-N |
| SMILES | O=C1C(C2C=CC(O)=CC=2)=COC2=CC(O[C@H]3[C@@H]([C@@H](O)[C@H](O)[C@@H](CO)O3)O)=CC=C12 |&1:16,17,18,20,22,r| |
| LogP | 0.369 (est) |
| CAS DataBase Reference | 552-66-9(CAS DataBase Reference) |
Description and Uses
A metabolite of isoflavone derivatives. A derivative of Daidzin. Inhibitor.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P280-P271 |
| Safety Statements | 24/25 |
| WGK Germany | 3 |
| RTECS | DJ3094000 |
| F | 10 |
| HS Code | 29389090 |
| Toxicity | mouse,LD50,intraperitoneal,> 2gm/kg (2000mg/kg),Pharmaceutical Chemistry Journal Vol. 13, Pg. 51, 1979. |
