A3167556
3,4-Dihydroxy-5-methoxy-benzoicacid , ≥97% , 3934-84-7
CAS NO.:3934-84-7
Empirical Formula: C8H8O5
Molecular Weight: 184.15
MDL number: MFCD00016518
EINECS: 223-512-8
| Pack Size | Price | Stock | Quantity |
| 100mg | RMB47.20 | In Stock |
|
| 250mg | RMB111.20 | In Stock |
|
| 1g | RMB255.20 | In Stock |
|
| 5g | RMB1039.20 | In Stock |
|
| 25g | RMB4215.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 220℃ |
| Boiling point: | 433.7±45.0 °C(Predicted) |
| Density | 1.499±0.06 g/cm3 (20 ºC 760 Torr) |
| storage temp. | Inert atmosphere,Room Temperature |
| solubility | DMSO (Slightly, Sonicated), Methanol (Slightly, Sonicated) |
| form | Solid |
| pka | 4.33±0.10(Predicted) |
| color | Off-White to Pale Brown |
| Water Solubility | Water: 2.2 mg/mL (11.95 mM) |
| InChI | InChI=1S/C8H8O5/c1-13-6-3-4(8(11)12)2-5(9)7(6)10/h2-3,9-10H,1H3,(H,11,12) |
| InChIKey | KWCCUYSXAYTNKA-UHFFFAOYSA-N |
| SMILES | C(O)(=O)C1=CC(OC)=C(O)C(O)=C1 |
| LogP | 1.190 (est) |
| CAS DataBase Reference | 3934-84-7(CAS DataBase Reference) |
Description and Uses
3-O-Methylgallic acid (3,4-Dihydroxy-5-methoxybenzoic acid) is an anthocyanin metabolite and has potent antioxidant capacity. 3-O-methylgallic acid inhibits Caco-2 cell proliferation with an IC50 value of 24.1 μM. 3-O-methylgallic acid also induces cell apoptosis and has anti-cancer effects[1][2][3].
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H332-H335 |
| Precautionary statements | P261-P280-P305+P351+P338 |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38-36 |
| Safety Statements | 26-36/37/39 |
| WGK Germany | WGK 3 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 |





