A3192612
2,5-Dichloronitrobenzene , 99% , 89-61-2
Synonym(s):
2,5-Dichloronitrobenzene;Nitro-p-dichlorobenzene
CAS NO.:89-61-2
Empirical Formula: C6H3Cl2NO2
Molecular Weight: 192
MDL number: MFCD00007074
EINECS: 201-923-3
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 52-54 °C(lit.) |
| Boiling point: | 267 °C |
| Density | 1,442 g/cm3 |
| vapor density | 6.6 (vs air) |
| vapor pressure | <0.1 mm Hg ( 25 °C) |
| refractive index | 1.4390 (estimate) |
| Flash point: | >230 °F |
| storage temp. | Store below +30°C. |
| solubility | 0.083g/l |
| form | solid |
| color | Pale Yellow |
| explosive limit | 2.4-8.5%(V) |
| Water Solubility | Soluble in water, ethanol, ether, benzene, carbon disulfide. Slightly soluble in carbon tetrachloride. |
| BRN | 778109 |
| InChI | 1S/C6H3Cl2NO2/c7-4-1-2-5(8)6(3-4)9(10)11/h1-3H |
| InChIKey | RZKKOBGFCAHLCZ-UHFFFAOYSA-N |
| SMILES | [O-][N+](=O)c1cc(Cl)ccc1Cl |
| LogP | 2.87 at 25℃ |
| CAS DataBase Reference | 89-61-2(CAS DataBase Reference) |
| IARC | 2B (Vol. 65, 123) 2020 |
| NIST Chemistry Reference | Benzene, 1,4-dichloro-2-nitro-(89-61-2) |
| EPA Substance Registry System | 2,5-Dichloronitrobenzene (89-61-2) |
Description and Uses
2,5-Dichloronitrobenzene is a reagent used in the synthesis of antitrypanosomal, antileishmanial and antimalarial agents. Also it is used in the synthesis of lysophosphatidic acid acyltransferase-β inhibitors.
Safety
| Symbol(GHS) | ![]() ![]() GHS07,GHS09 |
| Signal word | Warning |
| Hazard statements | H302-H411 |
| Precautionary statements | P273-P301+P312+P330 |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xn,N |
| Risk Statements | 22-36-51/53 |
| Safety Statements | 26-60 |
| RIDADR | UN 3077 9/PG 3 |
| WGK Germany | 2 |
| RTECS | CZ5260000 |
| TSCA | TSCA listed |
| HazardClass | 9 |
| PackingGroup | III |
| HS Code | 29049085 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral Aquatic Chronic 2 |
| Hazardous Substances Data | 89-61-2(Hazardous Substances Data) |






