A3253612
4,7-Dimethoxy-1,10-phenanthroline , 97% , 92149-07-0
| Pack Size | Price | Stock | Quantity |
| 250MG | RMB67.20 | In Stock |
|
| 1G | RMB211.20 | In Stock |
|
| 5g | RMB559.20 | In Stock |
|
| 25g | RMB2279.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 197-212 °C |
| Boiling point: | 373.1±37.0 °C(Predicted) |
| Density | 1.25 |
| storage temp. | 2-8°C |
| pka | 6.45±0.10(Predicted) |
| form | Crystalline Powder |
| color | White to brown |
| Sensitive | air sensitive |
| InChI | InChI=1S/C14H12N2O2/c1-17-11-5-7-15-13-9(11)3-4-10-12(18-2)6-8-16-14(10)13/h3-8H,1-2H3 |
| InChIKey | ZPGVCQYKXIQWTP-UHFFFAOYSA-N |
| SMILES | N1C2C(=CC=C3C=2N=CC=C3OC)C(OC)=CC=1 |
Description and Uses
Ligand for Cu-catalzyed N-arylation of imidazoles
Safety
| Symbol(GHS) | ![]() ![]() ![]() GHS05,GHS07,GHS09 |
| Signal word | Danger |
| Hazard statements | H302-H318-H400 |
| Precautionary statements | P264-P270-P273-P280-P301+P312-P305+P351+P338 |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xn,N |
| Risk Statements | 22-41-50 |
| Safety Statements | 26-39-61 |
| RIDADR | UN 3077 9/PG 3 |
| WGK Germany | 3 |
| TSCA | No |
| HazardClass | 9 |
| PackingGroup | Ⅲ |
| HS Code | 29339900 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral Aquatic Acute 1 Eye Dam. 1 |







