A3258612
3',5'-Difluoroacetophenone , 97% , 123577-99-1
CAS NO.:123577-99-1
Empirical Formula: C8H6F2O
Molecular Weight: 156.13
MDL number: MFCD00042489
EINECS: 626-379-8
| Pack Size | Price | Stock | Quantity |
| 1G | RMB32.00 | In Stock |
|
| 5G | RMB76.00 | In Stock |
|
| 25G | RMB195.20 | In Stock |
|
| 100g | RMB644.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 34-38 °C(lit.) |
| Boiling point: | 94 °C |
| Density | 1.206±0.06 g/cm3(Predicted) |
| refractive index | 1.4876 |
| Flash point: | 180 °F |
| storage temp. | Sealed in dry,Room Temperature |
| form | Low Melting Solid |
| color | White to slightly yellow |
| BRN | 6798740 |
| InChI | InChI=1S/C8H6F2O/c1-5(11)6-2-7(9)4-8(10)3-6/h2-4H,1H3 |
| InChIKey | OXJLDNSPGPBDCP-UHFFFAOYSA-N |
| SMILES | C(=O)(C1=CC(F)=CC(F)=C1)C |
| CAS DataBase Reference | 123577-99-1(CAS DataBase Reference) |
| NIST Chemistry Reference | 3,5-Difluoroacetophenone(123577-99-1) |
Description and Uses
3′,5′-Difluoroacetophenone (3,5-Difluoroacetophenone) may be used to synthesize:
- (E)-3-(4-(1,5,9-trithia-13-azacyclohexadecan-13-yl)-phenyl)-1-(3,5-difluorophenyl)prop-2-en-1-one
- 1,3,5-triarylpyrazoline fluorophores containing a 16-membered thiazacrown ligand
- (±)-fluorinated-1-(3-morpholin-4-yl-phenyl)ethylamine
- (E)-1-(3,5-difluorophenyl)-3-(2,4-dimethoxyphenyl) prop-2-en-1-one
- 1-(3,5-difluorophenyl)-4,4,4-trifluorobutane-1,3-dione
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38-R36/37/38-36-26 |
| Safety Statements | 26-36-S36-S26-36/37/38 |
| WGK Germany | 3 |
| HazardClass | IRRITANT |
| HS Code | 29147000 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |







