A3262612
3,4-Difluorobenzaldehyde , 98% , 34036-07-2
CAS NO.:34036-07-2
Empirical Formula: C7H4F2O
Molecular Weight: 142.1
MDL number: MFCD00010328
EINECS: 422-180-3
| Pack Size | Price | Stock | Quantity |
| 5G | RMB38.40 | In Stock |
|
| 25G | RMB124.00 | In Stock |
|
| 100G | RMB473.60 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 53-55°C (15 mmHg) |
| Density | 1.288 g/mL at 25 °C (lit.) |
| refractive index | n |
| Flash point: | 150 °F |
| storage temp. | Keep in dark place,Sealed in dry,Room Temperature |
| solubility | 3.962g/l |
| form | Liquid |
| Specific Gravity | 1.288 |
| color | Clear colorless to yellow |
| Sensitive | Air Sensitive |
| BRN | 2241231 |
| InChI | InChI=1S/C7H4F2O/c8-6-2-1-5(4-10)3-7(6)9/h1-4H |
| InChIKey | JPHKMYXKNKLNDF-UHFFFAOYSA-N |
| SMILES | C(=O)C1=CC=C(F)C(F)=C1 |
| CAS DataBase Reference | 34036-07-2(CAS DataBase Reference) |
Description and Uses
3,4-Difluorobenzaldehyde was used in the synthesis of 3-benzylidene 20,29-dihydrobetulinic acid derivatives.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H317-H319-H412 |
| Precautionary statements | P261-P273-P280-P301+P312-P302+P352-P305+P351+P338 |
| PPE | Eyeshields, Gloves, type ABEK (EN14387) respirator filter |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36-37/39-36/37 |
| WGK Germany | 2 |
| F | 10-21 |
| HazardClass | IRRITANT |
| HS Code | 29124990 |
| Storage Class | 10 - Combustible liquids |
| Hazard Classifications | Acute Tox. 4 Oral Aquatic Chronic 3 Eye Irrit. 2 Skin Irrit. 2 Skin Sens. 1 |
| REACH Registrations | Inactive |






