A3265412
3,5-Difluorobenzaldehyde , 98% , 32085-88-4
CAS NO.:32085-88-4
Empirical Formula: C7H4F2O
Molecular Weight: 142.1
MDL number: MFCD00010329
EINECS: 608-701-9
| Pack Size | Price | Stock | Quantity |
| 1G | RMB23.20 | In Stock |
|
| 5G | RMB44.80 | In Stock |
|
| 25G | RMB141.60 | In Stock |
|
| 100G | RMB425.60 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 17°C |
| Boiling point: | 61-63°C 43mm |
| Density | 1.296 g/mL at 20 °C (lit.) |
| refractive index | n |
| Flash point: | 133 °F |
| storage temp. | under inert gas (nitrogen or Argon) at 2-8°C |
| form | Liquid After Melting |
| color | Clear light green |
| Sensitive | Air Sensitive |
| BRN | 2573392 |
| InChI | InChI=1S/C7H4F2O/c8-6-1-5(4-10)2-7(9)3-6/h1-4H |
| InChIKey | ASOFZHSTJHGQDT-UHFFFAOYSA-N |
| SMILES | C(=O)C1=CC(F)=CC(F)=C1 |
| CAS DataBase Reference | 32085-88-4(CAS DataBase Reference) |
Description and Uses
The 19F{′H} spectra of 3,5-difluorobenzaldehyde at low temperature in dimethyl ether solution was studied.
Safety
| Symbol(GHS) | ![]() ![]() GHS02,GHS07 |
| Signal word | Warning |
| Hazard statements | H226-H315-H319 |
| Precautionary statements | P210-P233-P240-P241-P303+P361+P353-P305+P351+P338 |
| PPE | Eyeshields, Gloves, type ABEK (EN14387) respirator filter |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36-37/39 |
| RIDADR | UN 1989 3/PG 3 |
| WGK Germany | 3 |
| F | 10-21 |
| Hazard Note | Irritant |
| HazardClass | 3 |
| PackingGroup | III |
| HS Code | 29124990 |
| Storage Class | 3 - Flammable liquids |
| Hazard Classifications | Eye Irrit. 2 Flam. Liq. 3 Skin Irrit. 2 |
| Limited Quantities | 5.0 L (1.3 gallons) (liquid) |
| Excepted Quantities | Max Inner Pack (30g or 30ml) and Max Outer Pack (1Kg or 1L) |








