A3394412
Bis(pentafluorophenyl) carbonate , ≥98.0%(GC) , 59483-84-0
Synonym(s):
Pentafluorophenyl carbonate
CAS NO.：59483-84-0
Empirical Formula: C13F10O3
Molecular Weight: 394.12
MDL number: MFCD00368353
EINECS: 671-619-7
| Pack Size | Price | Stock | Quantity |
| 1G | RMB69.60 | In Stock |
|
| 5G | RMB200.80 | In Stock |
|
| 25G | RMB972.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 47-50 °C(lit.) |
| Boiling point: | 250°C |
| Density | 1.782±0.06 g/cm3(Predicted) |
| Flash point: | 110 °C |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | Soluble in chloroform, ethyl acetate and methylene chloride. |
| form | powder to crystal |
| color | White to Almost white |
| BRN | 2029727 |
| Major Application | peptide synthesis |
| InChI | InChI=1S/C13F10O3/c14-1-3(16)7(20)11(8(21)4(1)17)25-13(24)26-12-9(22)5(18)2(15)6(19)10(12)23 |
| InChIKey | IOVVFSGCNWQFQT-UHFFFAOYSA-N |
| SMILES | O(C1C(=C(F)C(F)=C(F)C=1F)F)C(=O)OC1C(=C(F)C(F)=C(F)C=1F)F |
| CAS DataBase Reference | 59483-84-0(CAS DataBase Reference) |
Description and Uses
Bis(pentafluorophenyl) carbonate can be used in the preparation of:
- A cyclic carbonate named 6,6′-(ethane-1,2-diyl)bis(1,3,6-dioxazocan-2-one), which is a key intermediate for the synthesis of non-isocyanate polyurethanes.
- A coumarin based aliphatic polycarbonate named 5-(4-methylumbelliferyloxycarbonyl)-5-methyl-1,3-dioxan-2-one (MUC).
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P305+P351+P338 |
| PPE | Eyeshields, Gloves, type N95 (US) |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 22-24/25 |
| WGK Germany | 3 |
| HazardClass | IRRITANT |
| HS Code | 29209090 |
| Storage Class | 11 - Combustible Solids |
