A5589912
Methyl Pentafluorophenyl Carbonate , >98.0%(GC) , 36919-03-6
CAS NO.：36919-03-6
Empirical Formula: C8H3F5O3
Molecular Weight: 242.1
MDL number: MFCD01075723
EINECS: 678-764-5
| Pack Size | Price | Stock | Quantity |
| 1G | RMB95.20 | In Stock |
|
| 5g | RMB375.20 | In Stock |
|
| 25g | RMB1487.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 24°C |
| Boiling point: | 84°C 3mm |
| Density | 1.567±0.06 g/cm3(Predicted) |
| Flash point: | 84°C/3mm |
| storage temp. | Sealed in dry,Room Temperature |
| form | powder to lump |
| color | White to Almost white |
| Water Solubility | Insoluble in water. |
| BRN | 2289710 |
| InChI | InChI=1S/C8H3F5O3/c1-15-8(14)16-7-5(12)3(10)2(9)4(11)6(7)13/h1H3 |
| InChIKey | HGYOVHMDBHQLOE-UHFFFAOYSA-N |
| SMILES | C(OC1=C(F)C(F)=C(F)C(F)=C1F)(=O)OC |
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319 |
| Precautionary statements | P280a-P301+P312a-P305+P351+P338-P321-P332+P313-P501a |
| Risk Statements | 22-36/38 |
| Safety Statements | 26-36/37/39 |
| RIDADR | 2811 |
| HS Code | 2920.90.5100 |
| HazardClass | 6.1 |
| PackingGroup | III |
