A3425112
N,N-Diethyl-o-toluidine , >98.0%(GC) , 606-46-2
CAS NO.：606-46-2
Empirical Formula: C11H17N
Molecular Weight: 163.26
MDL number: MFCD00059227
EINECS: 210-119-1
| Pack Size | Price | Stock | Quantity |
| 5ML | RMB38.40 | In Stock |
|
| 25ML | RMB112.80 | In Stock |
|
| 100ML | RMB348.00 | In Stock |
|
| 500ML | RMB951.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | -60°C |
| Boiling point: | 210°C |
| Density | 0,92 g/cm3 |
| refractive index | 1.5040-1.5070 |
| Water Solubility | Soluble in water |
| form | clear liquid |
| pka | 7.24(at 25℃) |
| Specific Gravity | 0.905 (20/4℃) |
| color | Colorless to Light yellow to Light orange |
| InChI | InChI=1S/C11H17N/c1-4-12(5-2)11-9-7-6-8-10(11)3/h6-9H,4-5H2,1-3H3 |
| InChIKey | YQYUUNRAPYPAPC-UHFFFAOYSA-N |
| SMILES | C1(N(CC)CC)=CC=CC=C1C |
| CAS DataBase Reference | 606-46-2(CAS DataBase Reference) |
| EPA Substance Registry System | Benzenamine, N,N-diethyl-2-methyl- (606-46-2) |
Description and Uses
N,n-diethyl-o-toluidine is used in organic synthesis.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302+H312+H332-H315-H319 |
| Precautionary statements | P261-P264-P270-P271-P280-P301+P312+P330-P302+P352+P312+P362+P364-P304+P340+P312-P305+P351+P338+P337+P313-P501 |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36/37/39 |
| HS Code | 2921490090 |
