A3449412
Disodium Fumarate , >98.0%(T) , 17013-01-3
Synonym(s):
Disodium fumarate;di-Sodium fumarate;Fumaric acid disodium salt
CAS NO.:17013-01-3
Empirical Formula: C4H4O4.2Na
Molecular Weight: 160.04
MDL number: MFCD00064567
EINECS: 241-087-7
| Pack Size | Price | Stock | Quantity |
| 25G | RMB30.40 | In Stock |
|
| 100G | RMB183.20 | In Stock |
|
| 500G | RMB632.00 | In Stock |
|
| 2.5kg | RMB767.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | >300°C |
| storage temp. | Store below +30°C. |
| solubility | 228g/l |
| form | Crystalline Powder |
| color | White |
| PH | 7-8 (50g/l, H2O) |
| Odor | Odorless |
| Water Solubility | 228 g/L |
| Sensitive | Hygroscopic |
| Hydrolytic Sensitivity | 0: forms stable aqueous solutions |
| BRN | 4301302 |
| Cosmetics Ingredients Functions | BUFFERING |
| Cosmetic Ingredient Review (CIR) | Disodium fumarate (17013-01-3) |
| InChI | InChI=1S/C4H4O4.Na.H/c5-3(6)1-2-4(7)8;;/h1-2H,(H,5,6)(H,7,8);;/b2-1+;; |
| InChIKey | GRGUKBNLSYVJML-SEPHDYHBSA-N |
| SMILES | C(/C(=O)O)=C\C(=O)O.[NaH] |
| LogP | -0.008 (est) |
| CAS DataBase Reference | 17013-01-3(CAS DataBase Reference) |
Description and Uses
Disodium Fumarate can be used to reduce or prevent dilution of target protein during recovery flush after filtration.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P280a-P304+P340-P305+P351+P338-P405-P501a |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36-37/39 |
| WGK Germany | 2 |
| RTECS | LT1830000 |
| F | 3 |
| TSCA | No |
| HS Code | 2917 19 80 |
| Storage Class | 11 - Combustible Solids |
| Toxicity | human,TDLo,oral,215mg/kg (215mg/kg),GASTROINTESTINAL: OTHER CHANGESGASTROINTESTINAL: "HYPERMOTILITY, DIARRHEA"GASTROINTESTINAL: NAUSEA OR VOMITING,Journal of the American Pharmaceutical Association, Scientific Edition. Vol. 31, Pg. 1, 1942. |







