PRODUCT Properties
| Melting point: | 48-50 °C (lit.) |
| Boiling point: | 255 °C (lit.) |
| Density | 0.9418 (rough estimate) |
| vapor pressure | 0.004Pa at 20℃ |
| refractive index | 1.4561 (estimate) |
| Flash point: | 113 °C |
| storage temp. | -20°C Freezer |
| solubility | Chloroform (Slightly), DMSO (Slightly), Methanol (Slightly) |
| pka | 14.48±0.20(Predicted) |
| form | Solid |
| color | White to Off-White |
| Water Solubility | 579mg/L at 20℃ |
| InChI | InChI=1S/C10H22O2/c1-2-3-4-5-6-7-8-10(12)9-11/h10-12H,2-9H2,1H3 |
| InChIKey | YSRSBDQINUMTIF-UHFFFAOYSA-N |
| SMILES | C(O)C(O)CCCCCCCC |
| LogP | 1.99 at 22.4℃ |
| CAS DataBase Reference | 1119-86-4(CAS DataBase Reference) |
Description and Uses
1,2-Decanediol is a 1,2-alkanediol that is used as an antimicrobial agent in cosmetics. It also suppresses the fluidity of the hydrophilic and hydrophobic groups in the phospholipid membrane of liposomes. Preparation of 1-decene by deoxygenation of 1,2-decanediol with formic acid. It is used to Synthesis of EDOT-C8.
Safety
| Symbol(GHS) |  GHS05 |
| Signal word | Danger |
| Hazard statements | H318 |
| Precautionary statements | P280-P305+P351+P338-P310 |
| Safety Statements | 24/25 |
| WGK Germany | 2 |
| HS Code | 29053995 |
