A3558912
1,3-Dibromoadamantane , >97.0%(GC) , 876-53-9
CAS NO.：876-53-9
Empirical Formula: C10H14Br2
Molecular Weight: 294.03
MDL number: MFCD00077218
EINECS: 1533716-785-6
| Pack Size | Price | Stock | Quantity |
| 1g | RMB62.40 | In Stock |
|
| 5G | RMB112.00 | In Stock |
|
| 25G | RMB343.20 | In Stock |
|
| 100g | RMB685.60 | In Stock |
|
| 500g | RMB2399.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 108-110 °C (lit.) |
| Boiling point: | 287.6±13.0 °C(Predicted) |
| Density | 1.864±0.06 g/cm3(Predicted) |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | Chloroform (Slightly), Ethyl Acetate (Slightly) |
| form | Solid |
| color | White to Pale Gray |
| InChI | InChI=1S/C10H14Br2/c11-9-2-7-1-8(4-9)5-10(12,3-7)6-9/h7-8H,1-6H2 |
| InChIKey | HLWZKLMEOVIWRK-UHFFFAOYSA-N |
| SMILES | C12(Br)CC3CC(CC(Br)(C3)C1)C2 |
| CAS DataBase Reference | 876-53-9(CAS DataBase Reference) |
Description and Uses
1,3-Dibromoadamantane may be used in the preparation of 1,3-bis(phenyldimethylsilyl)adamantine.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P261-P301+P312-P302+P352-P304+P340-P305+P351+P338 |
| PPE | Eyeshields, Gloves, type N95 (US) |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| WGK Germany | 3 |
| HazardClass | IRRITANT |
| HS Code | 2902190000 |
| Storage Class | 11 - Combustible Solids |
