A3786912
2',3'-Dichloroacetophenone , 98% , 56041-57-7
CAS NO.:56041-57-7
Empirical Formula: C8H6Cl2O
Molecular Weight: 189.04
MDL number: MFCD00052988
EINECS: 259-954-3
| Pack Size | Price | Stock | Quantity |
| 250mg | RMB32.80 | In Stock |
|
| 1g | RMB51.20 | In Stock |
|
| 5G | RMB215.20 | In Stock |
|
| 25G | RMB875.44 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 125-127 °C |
| Boiling point: | 67 °C |
| Density | 1.293 |
| refractive index | 1.558 |
| Flash point: | 106-108°C/2mm |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | Chloroform (Slightly), Ethyl Acetate (Slightly) |
| form | Solid |
| color | Colourless |
| BRN | 2438815 |
| InChI | InChI=1S/C8H6Cl2O/c1-5(11)6-3-2-4-7(9)8(6)10/h2-4H,1H3 |
| InChIKey | KMABBMYSEVZARZ-UHFFFAOYSA-N |
| SMILES | C(=O)(C1=CC=CC(Cl)=C1Cl)C |
| CAS DataBase Reference | 56041-57-7(CAS DataBase Reference) |
Description and Uses
2,3''-Dichloroacetophenone is used as a reagent in the synthesis of benzothiazepinones (BTZs) as novel non-ATP competitive inhibitors of glycogen synthase kinase-3β (GSK-3β). Also used as a reagent in the synthesis of benzimidazolyl pyridinones as insulin-like growth factor I (IGF-1R) kinase inhibitors.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P305+P351+P338-P405-P501a-P261-P280a-P304+P340 |
| Hazard Codes | Xi,Xn |
| Risk Statements | 36/38-36/37/38-22 |
| Safety Statements | 26-36/37/39-37/39-36 |
| Hazard Note | Irritant |
| HS Code | 2914790090 |







