A4003512
Ethyl N-Boc-4-methylpiperidine-4-carboxylate , 97% , 189442-87-3
Synonym(s):
1-tert-Butoxycarbonyl-4-methylpiperidine-4-carboxylic acid ethyl ester;4-Methyl-1,4-piperidinedicarboxylic acid 1-(1,1-dimethylethyl) 4-ethyl ester
| Pack Size | Price | Stock | Quantity |
| 250mg | RMB103.20 | In Stock |
|
| 1G | RMB200.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 329.7±35.0 °C(Predicted) |
| Density | 1.0134 g/mL at 25 °C |
| refractive index | 1.4554 |
| Flash point: | 110 °C |
| storage temp. | 2-8°C |
| pka | -2.20±0.40(Predicted) |
| Appearance | Colorless to light yellow Liquid |
| InChI | 1S/C14H25NO4/c1-6-18-11(16)14(5)7-9-15(10-8-14)12(17)19-13(2,3)4/h6-10H2,1-5H3 |
| InChIKey | ZQZVWDXMUCTNRI-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1(C)CCN(CC1)C(=O)OC(C)(C)C |
Description and Uses
Reactant for synthesis of:
- Dipeptidyl peptidase-4 inhibitor ABT-279
- Building blocks for piperazine-based CCR5 antagonists
Safety
| Symbol(GHS) | ![]() ![]() GHS05,GHS06 |
| Signal word | Danger |
| Hazard statements | H301-H315-H318-H335 |
| Precautionary statements | P280-P301+P310+P330-P302+P352-P305+P351+P338+P310 |
| target organs | Respiratory system |
| PPE | Eyeshields, Faceshields, Gloves, type ABEK (EN14387) respirator filter |
| Hazard Codes | T |
| Risk Statements | 25-37/38-41 |
| Safety Statements | 26-36/37/39-45 |
| RIDADR | UN 2810 |
| WGK Germany | 3 |
| HazardClass | IRRITANT |
| Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects |
| Hazard Classifications | Acute Tox. 3 Oral Eye Dam. 1 Skin Irrit. 2 STOT SE 3 |




![tert-butyl N-[4-(tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]carbamate](https://img.chemicalbook.com/CAS/GIF/330793-01-6.gif)



