4'-Ethylpropiophenone , 96% , 27465-51-6
CAS NO.:27465-51-6
Empirical Formula: C11H14O
Molecular Weight: 162.23
MDL number: MFCD00191646
EINECS: 2017-001-1
| Pack Size | Price | Stock | Quantity |
| 25ML | RMB199.20 | In Stock |
|
| 100ML | RMB479.20 | In Stock |
|
| 500ML | RMB1599.20 | In Stock |
|
| others | Enquire |
PRODUCT Properties
| Boiling point: | 246 °C |
| Density | 0.98 |
| refractive index | 1.5220-1.5260 |
| storage temp. | Sealed in dry,Room Temperature |
| Specific Gravity | 0.98 |
| Appearance | Colorless to light yellow Liquid |
| InChI | InChI=1S/C11H14O/c1-3-9-5-7-10(8-6-9)11(12)4-2/h5-8H,3-4H2,1-2H3 |
| InChIKey | VGQRIILEZYZAOE-UHFFFAOYSA-N |
| SMILES | C(C1=CC=C(CC)C=C1)(=O)CC |
| CAS DataBase Reference | 27465-51-6(CAS DataBase Reference) |
Description and Uses
4'-Ethylpropiophenone is a synthetic chemical that belongs to the class of piperidine hydrochloride. It emits light when it reacts with inorganic acid and has a constant for its wavelength. It is synthesized by the reaction of crambidae with molybdenum, which results in the formation of hydroxyl group and chloride. The compound can be dehydrated by reacting with hydroxyl group and chloride, which leads to its formation. 4'-Ethylpropiophenone has been shown to have an effect on lepidoptera larvae, acting as an insecticide, but has not been studied for effects on humans or other mammals.
An impurity of Eperisone (E565800) as muscle relaxant and analgesic.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H317-H412-H335-H302 |
| Precautionary statements | P264-P280-P302+P352-P321-P332+P313-P362-P264-P270-P301+P312-P330-P501-P273-P501-P264-P280-P305+P351+P338-P337+P313P-P261-P272-P280-P302+P352-P333+P313-P321-P363-P501 |
| Hazard Codes | Xi |
| Safety Statements | 24/25 |
| HazardClass | IRRITANT |
| HS Code | 29143990 |






