A4044712
Ethyl 2,6-Dichloronicotinate , >98.0%(GC) , 58584-86-4
| Pack Size | Price | Stock | Quantity |
| 1G | RMB142.40 | In Stock |
|
| 5G | RMB534.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 50.0 to 54.0 °C |
| Boiling point: | 286.0±35.0 °C(Predicted) |
| Density | 1.367±0.06 g/cm3(Predicted) |
| storage temp. | under inert gas (nitrogen or Argon) at 2-8°C |
| solubility | soluble in Methanol |
| form | powder to crystal |
| pka | -4.48±0.10(Predicted) |
| color | White to Light yellow |
| InChI | InChI=1S/C8H7Cl2NO2/c1-2-13-8(12)5-3-4-6(9)11-7(5)10/h3-4H,2H2,1H3 |
| InChIKey | KKYBVLDQTWQETN-UHFFFAOYSA-N |
| SMILES | C1(Cl)=NC(Cl)=CC=C1C(OCC)=O |
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319 |
| Precautionary statements | P264-P280-P302+P352-P337+P313-P305+P351+P338-P362+P364-P332+P313 |
| HS Code | 2933399990 |
| REACH Registrations | Active |






