A4280612
4-Fluorocinnamic acid , 99% , 459-32-5
CAS NO.:459-32-5
Empirical Formula: C9H7FO2
Molecular Weight: 166.15
MDL number: MFCD00004395
EINECS: 207-288-9
| Pack Size | Price | Stock | Quantity |
| 5G | RMB29.60 | In Stock |
|
| 25G | RMB67.20 | In Stock |
|
| 100G | RMB187.20 | In Stock |
|
| 500g | RMB758.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 209-210 °C (lit.) |
| Boiling point: | 290°C (rough estimate) |
| Density | 1.2247 (estimate) |
| storage temp. | Sealed in dry,Room Temperature |
| pka | 4.43±0.10(Predicted) |
| form | Crystalline Solid |
| color | White to off-white |
| BRN | 2613441 |
| InChI | InChI=1S/C9H7FO2/c10-8-4-1-7(2-5-8)3-6-9(11)12/h1-6H,(H,11,12) |
| InChIKey | ISMMYAZSUSYVQG-UHFFFAOYSA-N |
| SMILES | C(O)(=O)C=CC1=CC=C(F)C=C1 |
| CAS DataBase Reference | 459-32-5(CAS DataBase Reference) |
| NIST Chemistry Reference | 4-Fluorocinnamic acid(459-32-5) |
Description and Uses
4-Fluorocinnamic acid was used in growth medium for the Arthrobacter sp. strain G1.
Safety
| Symbol(GHS) | ![]() GHS06 |
| Signal word | Danger |
| Hazard statements | H301-H315-H319-H335 |
| Precautionary statements | P261-P264-P270-P301+P310-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | Eyeshields, Gloves, type N95 (US) |
| Hazard Codes | Xi,C |
| Risk Statements | 36/37/38-34 |
| Safety Statements | 37/39-26-45-36/37/39-27-24/25 |
| WGK Germany | 3 |
| HazardClass | IRRITANT |
| HS Code | 29163900 |
| Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects |
| Hazard Classifications | Acute Tox. 3 Oral Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |






