A4288512
Fmoc-Ala-OH , 98% , 35661-39-3
Synonym(s):
Fmoc-Ala-OH;FMOC-?-ALA-OH;Fmoc-L -alanine;N-α-Fmoc-L-alanine monohydrate;N-β-Fmoc-β-alanine
CAS NO.:35661-39-3
Empirical Formula: C18H17NO4
Molecular Weight: 311.33
MDL number: MFCD00037139
EINECS: 252-660-6
| Pack Size | Price | Stock | Quantity |
| 5G | RMB23.20 | In Stock |
|
| 25G | RMB74.40 | In Stock |
|
| 100G | RMB227.20 | In Stock |
|
| 500g | RMB910.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 147-153 °C (lit.) |
| alpha | -19 º (c=1,DMF) |
| Boiling point: | 451.38°C (rough estimate) |
| Density | 1.2626 (rough estimate) |
| refractive index | -18.5 ° (C=1, DMF) |
| storage temp. | Store below +30°C. |
| solubility | DMSO (Slightly), DMF (Sparingly), Methanol (Slightly) |
| form | Solid |
| pka | 3.91±0.10(Predicted) |
| color | White |
| optical activity | [α]20/D 18°, c = 1 in DMF |
| Water Solubility | Soluble in water. |
| BRN | 2225975 |
| Major Application | peptide synthesis |
| InChI | 1S/C18H17NO4/c1-11(17(20)21)19-18(22)23-10-16-14-8-4-2-6-12(14)13-7-3-5-9-15(13)16/h2-9,11,16H,10H2,1H3,(H,19,22)(H,20,21)/t11-/m0/s1 |
| InChIKey | QWXZOFZKSQXPDC-NSHDSACASA-N |
| SMILES | C[C@H](NC(=O)OCC1c2ccccc2-c3ccccc13)C(O)=O |
| CAS DataBase Reference | 35661-39-3(CAS DataBase Reference) |
| CAS Number Unlabeled | 35661-39-3 |
Description and Uses
FMOC-Ala-OH is a versatile reagent used in Fmoc solid-phase peptide synthesis.
FMOC-Ala-OH is potentially useful for proteomics studies and solid phase peptide synthesis techniques. Alanine is one of the simplest amino acids - a methyl group as the side chain. This small side chain confers a high degree of flexibility when incorporated into a polypeptide chain. The Fmoc group is typically removed with a base such as pyridine - an orthogonal de-protection strategy to the acid labilie Boc group.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P271-P280 |
| PPE | Eyeshields, Gloves, type N95 (US) |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 24/25-36/37/39-27-26 |
| WGK Germany | 3 |
| HazardClass | IRRITANT |
| HS Code | 29242990 |
| Storage Class | 11 - Combustible Solids |







