A4313212
Fmoc-Cys(Acm)-OH , 98% , 86060-81-3
Synonym(s):
Nα-Fmoc-S-acetaminomethyl-L -cysteine;Fmoc-Cys(Acm)-OH;N-α-Fmoc-S-acetamidomethyl-L-cysteine
| Pack Size | Price | Stock | Quantity |
| 1g | RMB28.00 | In Stock |
|
| 5G | RMB62.40 | In Stock |
|
| 25G | RMB242.40 | In Stock |
|
| 100G | RMB782.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 147-150 °C |
| Boiling point: | 714.1±60.0 °C(Predicted) |
| Density | 1.327±0.06 g/cm3(Predicted) |
| storage temp. | 2-8°C |
| solubility | Soluble in Chloroform,Dichloromethane,Ethyl Acetate,DMSO,Acetone,etc. |
| form | Powder |
| pka | 3.43±0.10(Predicted) |
| color | White to off-white |
| optical activity | [α]/D -33.0±2.0°, c = 1 in methanol |
| BRN | 4725388 |
| InChIKey | CSMYOORPUGPKAP-IBGZPJMESA-N |
| SMILES | C(O)(=O)[C@H](CSCNC(C)=O)NC(OCC1C2=C(C=CC=C2)C2=C1C=CC=C2)=O |
| CAS DataBase Reference | 86060-81-3(CAS DataBase Reference) |
Description and Uses
Fmoc-cys(acm)-oh, is an amino acid building block used in peptide synthesis. With a growing peptide drug market the fast, reliable synthesis of peptides is of great importance.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P302+P352-P305+P351+P338 |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| WGK Germany | 3 |
| HS Code | 29309090 |
