A4321112
Fmoc-4-Nitro-L-Phenylalanine , 98% , 95753-55-2
Synonym(s):
Fmoc-4-nitro-L -phenylalanine;Fmoc-Phe(4-NO₂)-OH;N-α-Fmoc-4-nitro-L-phenylalanine
| Pack Size | Price | Stock | Quantity |
| 1G | RMB46.40 | In Stock |
|
| 5G | RMB163.20 | In Stock |
|
| 25G | RMB717.60 | In Stock |
|
| 100g | RMB2381.60 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 213-223℃ |
| Boiling point: | 692.3±55.0 °C(Predicted) |
| Density | 1.371±0.06 g/cm3(Predicted) |
| storage temp. | Sealed in dry,2-8°C |
| solubility | almost transparency in N,N-DMF |
| form | powder to crystal |
| pka | 3.59±0.10(Predicted) |
| color | White to Light yellow |
| BRN | 5178656 |
| Major Application | peptide synthesis |
| InChIKey | RZRRJPNDKJOLHI-QFIPXVFZSA-N |
| SMILES | [N+](=O)([O-])c1ccc(cc1)C[C@H](NC(=O)OCC2c3c(cccc3)c4c2cccc4)C(=O)O |
| CAS DataBase Reference | 95753-55-2(CAS DataBase Reference) |
Description and Uses
Fmoc-Phe(4-NO2)-OH is used to prepare squaric acid derivatives as VLA-4 integrin antagonists. It is also an intermediate used in the synthesis of analogs of kahalalide F.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P261-P305+P351+P338 |
| Hazard Codes | Xi |
| Safety Statements | 22-24/25 |
| WGK Germany | 3 |
| HS Code | 2924 29 70 |
| HazardClass | IRRITANT |
| Storage Class | 11 - Combustible Solids |







