A4311212
Fmoc-allyl-L-glycine , 98% , 146549-21-5
CAS NO.：146549-21-5
Empirical Formula: C20H19NO4
Molecular Weight: 337.37
MDL number: MFCD01311749
EINECS: 1592732-453-0
| Pack Size | Price | Stock | Quantity |
| 250mg | RMB70.40 | In Stock |
|
| 1G | RMB180.80 | In Stock |
|
| 5G | RMB727.20 | In Stock |
|
| 25G | RMB2424.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 137.1 °C |
| Boiling point: | 473.68°C (rough estimate) |
| Density | 1.2486 (rough estimate) |
| refractive index | 1.5800 (estimate) |
| storage temp. | 2-8°C |
| solubility | Chloroform (Sparingly), DMSO (Slightly), Methanol (Slightly) |
| form | Solid |
| pka | 3.72±0.10(Predicted) |
| color | White to Off-White |
| optical activity | -8.633° (C=0.01 g/ml, DMF) |
| Water Solubility | Slightly soluble in water. |
| InChI | InChI=1S/C20H19NO4/c1-2-7-18(19(22)23)21-20(24)25-12-17-15-10-5-3-8-13(15)14-9-4-6-11-16(14)17/h2-6,8-11,17-18H,1,7,12H2,(H,21,24)(H,22,23)/t18-/m0/s1 |
| InChIKey | YVBLQCANYSFEBN-SFHVURJKSA-N |
| SMILES | C(O)(=O)[C@@H](NC(OCC1C2=C(C=CC=C2)C2=C1C=CC=C2)=O)CC=C |
| CAS DataBase Reference | 146549-21-5(CAS DataBase Reference) |
Description and Uses
2-Allyl-N-Fmoc-L-glycine is potentially useful for solid phase peptide synthesis techniques. 2-Allyl-N-Fmoc-L-glycine compound could be useful as an unusual amino acid analog to aid in the deconvolution of protein structure and function. Reagent in the synthesis of a Dicarba-Analog of Octreotide.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P261-P305+P351+P338 |
| Hazard Codes | Xi |
| Safety Statements | 24/25 |
| WGK Germany | 3 |
| HazardClass | IRRITANT |
| HS Code | 29242990 |
