A4319212
Fmoc-3-(1-naphthyl)-D-Alanine , ≥98.5% , 138774-93-3
Synonym(s):
Fmoc-3-(1-naphthyl)-D -alanine
| Pack Size | Price | Stock | Quantity |
| 250mg | RMB57.60 | In Stock |
|
| 1g | RMB146.40 | In Stock |
|
| 5G | RMB488.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 690.7±50.0 °C(Predicted) |
| Density | 1.296±0.06 g/cm3(Predicted) |
| storage temp. | 2-8°C |
| pka | 3.77±0.30(Predicted) |
| form | Solid |
| color | White to off-white |
| BRN | 9160026 |
| Major Application | peptide synthesis |
| InChIKey | ORWNVJDLEMVDLV-JKXWNSIXNA-N |
| SMILES | C1(COC(=O)N[C@@H](C(=O)O)CC2C=CC=C3C=CC=CC=23)C2C=CC=CC=2C2C=CC=CC1=2 |&1:6,r| |
| CAS DataBase Reference | 138774-93-3(CAS DataBase Reference) |
Description and Uses
Fmoc-d-1-naphthylalanine, is an amino acid derivative used in chemical synthesis and peptide chemistry.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302 |
| Precautionary statements | P280-P305+P351+P338 |
| PPE | Eyeshields, Gloves, type N95 (US) |
| Hazard Codes | Xi |
| Safety Statements | 22-24/25 |
| WGK Germany | 3 |
| HazardClass | IRRITANT |
| HS Code | 29242990 |
| Storage Class | 11 - Combustible Solids |







