A4322412
N-Fmoc-N-Methyl-O-tert-butyl-L-serine , 98% , 197632-77-2
Synonym(s):
Fmoc-N-α-methyl-O-t-butyl-L-serine;Fmoc-N-Me-Ser(tBu)-OH
CAS NO.:197632-77-2
Empirical Formula: C23H27NO5
Molecular Weight: 397.46
MDL number: MFCD02094430
EINECS: 1533716-785-6
| Pack Size | Price | Stock | Quantity |
| 250MG | RMB180.80 | In Stock |
|
| 1G | RMB261.60 | In Stock |
|
| 5G | RMB986.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 213-218℃ |
| Boiling point: | 557.5±50.0 °C(Predicted) |
| Density | 1.204±0.06 g/cm3(Predicted) |
| storage temp. | Store at +2°C to +8°C. |
| solubility | Soluble in Chloroform,Dichloromethane,Ethyl Acetate,DMSO,Acetone,etc. |
| form | Crystalline Solid |
| pka | 3.46±0.10(Predicted) |
| color | White to off-white |
| Major Application | peptide synthesis |
| InChI | InChI=1S/C23H27NO5/c1-23(2,3)29-14-20(21(25)26)24(4)22(27)28-13-19-17-11-7-5-9-15(17)16-10-6-8-12-18(16)19/h5-12,19-20H,13-14H2,1-4H3,(H,25,26)/t20-/m0/s1 |
| InChIKey | PQSAXALAXPNFMG-FQEVSTJZSA-N |
| SMILES | C(O)(=O)[C@H](COC(C)(C)C)N(C(OCC1C2=C(C=CC=C2)C2=C1C=CC=C2)=O)C |
| CAS DataBase Reference | 197632-77-2(CAS DataBase Reference) |
Description and Uses
peptide synthesis
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P261-P301+P312-P302+P352-P304+P340-P305+P351+P338 |
| WGK Germany | 3 |
| HS Code | 2924 29 70 |
| HazardClass | IRRITANT |
| Storage Class | 13 - Non Combustible Solids |







