BD8577331
Fmoc-N-Me-Thr(tBu)-OH , 95% , 117106-20-4
Synonym(s):
Fmoc-N-methyl-O-tert-butyl-L -threonine;Fmoc-N-Me-Thr(tBu)-OH;N-α-Fmoc-N-α-methyl-O-tert-butyl-L-threonine
| Pack Size | Price | Stock | Quantity |
| 100mg | RMB108.00 | In Stock |
|
| 250mg | RMB164.00 | In Stock |
|
| 1g | RMB360.80 | In Stock |
|
| 5g | RMB1330.40 | In Stock |
|
| 10g | RMB2286.40 | In Stock |
|
| 25g | RMB4580.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 220-225°C |
| Boiling point: | 562.4±50.0 °C(Predicted) |
| Density | 1.185±0.06 g/cm3(Predicted) |
| storage temp. | Store at +2°C to +8°C. |
| solubility | Soluble in Chloroform,Dichloromethane,Ethyl Acetate,DMSO,Acetone,etc. |
| pka | 3.43±0.10(Predicted) |
| form | Solid |
| color | Off-white to light yellow |
| optical activity | [α]22/D +16.0°, c = 0.5% in methanol |
| Major Application | peptide synthesis |
| InChI | 1S/C24H29NO5/c1-15(30-24(2,3)4)21(22(26)27)25(5)23(28)29-14-20-18-12-8-6-10-16(18)17-11-7-9-13-19(17)20/h6-13,15,20-21H,14H2,1-5H3,(H,26,27)/t15-,21+/m1/s1 |
| InChIKey | VIUVLZHFMIFLHU-FXMQYSIJSA-N |
| SMILES | C(O)(=O)[C@H]([C@H](OC(C)(C)C)C)N(C(OCC1C2=C(C=CC=C2)C2=C1C=CC=C2)=O)C |
| CAS DataBase Reference | 117106-20-4(CAS DataBase Reference) |
Description and Uses
(2S,3R)-2-((((9H-Fluoren-9-yl)methoxy)carbonyl)(methyl)amino)-3-(tert-butoxy)butanoic Acid is a Threonine derivative that has been used for the preparation of antifungal cyclic depsipeptide petriellin .
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P280-P302+P352 |
| WGK Germany | 3 |
| HS Code | 2924 29 70 |
| HazardClass | IRRITANT |
| Storage Class | 13 - Non Combustible Solids |
