PRODUCT Properties
| Melting point: | 158-160 °C (lit.) |
| Boiling point: | 261.2±20.0 °C(Predicted) |
| Density | 1.258±0.06 g/cm3(Predicted) |
| storage temp. | Sealed in dry,Room Temperature |
| form | crystalline powder |
| pka | 3.61±0.10(Predicted) |
| color | White |
| InChI | InChI=1S/C8H7FO2/c1-5-6(8(10)11)3-2-4-7(5)9/h2-4H,1H3,(H,10,11) |
| InChIKey | XMKZAIHFVHJGPV-UHFFFAOYSA-N |
| SMILES | C(O)(=O)C1=CC=CC(F)=C1C |
| CAS DataBase Reference | 699-90-1(CAS DataBase Reference) |
Description and Uses
3-Fluoro-2-methylbenzoic acid was used in the GC-MS detection of metabolites from cell cultures containing 6-fluoro-3-methylphenol.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P280a-P304+P340-P305+P351+P338-P405-P501a |
| PPE | Eyeshields, Gloves, type N95 (US) |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36/37/39 |
| WGK Germany | 3 |
| Hazard Note | Irritant |
| HS Code | 2916399090 |
| Storage Class | 11 - Combustible Solids |






