A4338512
4-Fluoro-2-(trifluoromethyl)benzoic Acid , 98% , 141179-72-8
CAS NO.:141179-72-8
Empirical Formula: C8H4F4O2
Molecular Weight: 208.11
MDL number: MFCD00040982
EINECS: 256-495-9
| Pack Size | Price | Stock | Quantity |
| 1G | RMB29.60 | In Stock |
|
| 5G | RMB47.20 | In Stock |
|
| 25g | RMB162.40 | In Stock |
|
| 100g | RMB604.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 121-124 °C (lit.) |
| Boiling point: | 239.0±40.0 °C(Predicted) |
| Density | 1.4412 (estimate) |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | Methanol[soluble in] |
| solubility | soluble in Methanol |
| form | Needle-Like Crystalline Powder |
| pka | 3.17±0.36(Predicted) |
| color | Slightly yellow |
| InChI | InChI=1S/C8H4F4O2/c9-4-1-2-5(7(13)14)6(3-4)8(10,11)12/h1-3H,(H,13,14) |
| InChIKey | JUHPDXOIGLHXTC-UHFFFAOYSA-N |
| SMILES | C(O)(=O)C1=CC=C(F)C=C1C(F)(F)F |
| CAS DataBase Reference | 141179-72-8(CAS DataBase Reference) |
Description and Uses
4-Fluoro-2-(trifluoromethyl)benzoic acid is a substituted benzoic acid derivative. Molecular orbital and empirical methods have been utilized to determine its computed steric and electronic properties.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| WGK Germany | 3 |
| HazardClass | IRRITANT |
| HS Code | 29163990 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |






