A4355412
4-Fluoro-2-nitrobenzoic acid , >98.0%(GC) , 394-01-4
CAS NO.：394-01-4
Empirical Formula: C7H4FNO4
Molecular Weight: 185.11
MDL number: MFCD00024300
EINECS: 206-890-9
| Pack Size | Price | Stock | Quantity |
| 1G | RMB27.20 | In Stock |
|
| 5G | RMB40.00 | In Stock |
|
| 25G | RMB138.40 | In Stock |
|
| 100G | RMB511.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 140-145 °C (lit.) |
| Boiling point: | 343.8±27.0 °C(Predicted) |
| Density | 1.568±0.06 g/cm3(Predicted) |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | soluble in Methanol |
| form | powder to crystal |
| pka | 2.14±0.25(Predicted) |
| color | White to Light yellow |
| InChI | InChI=1S/C7H4FNO4/c8-4-1-2-5(7(10)11)6(3-4)9(12)13/h1-3H,(H,10,11) |
| InChIKey | YLUCXHMYRQUERW-UHFFFAOYSA-N |
| SMILES | C(O)(=O)C1=CC=C(F)C=C1[N+]([O-])=O |
| CAS DataBase Reference | 394-01-4(CAS DataBase Reference) |
Description and Uses
4-Fluoro-2-nitrobenzoic acid has been used to study the reactions of substituted pyridines with the salicyl phosphate dianion.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P280a-P304+P340-P305+P351+P338-P405-P501a |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36/37/39-37 |
| WGK Germany | 3 |
| HazardClass | IRRITANT |
| HS Code | 29163990 |
