A4360012
(Formylmethyl)triphenylphosphonium chloride , >98.0% , 62942-43-2
Synonym(s):
2-Oxoethyltriphenylphosphonium chloride
CAS NO.:62942-43-2
Empirical Formula: C20H18ClOP
Molecular Weight: 340.78
MDL number: MFCD00012003
EINECS: 263-767-2
| Pack Size | Price | Stock | Quantity |
| 5g | RMB67.20 | In Stock |
|
| 10G | RMB124.00 | In Stock |
|
| 25g | RMB221.60 | In Stock |
|
| 50G | RMB399.20 | In Stock |
|
| 100g | RMB783.20 | In Stock |
|
| 250G | RMB1919.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 209-212 °C (dec.) (lit.) |
| storage temp. | 2-8°C |
| form | solid |
| color | Light yellow to Yellow to Orange |
| Water Solubility | Soluble in water. |
| Sensitive | Hygroscopic |
| BRN | 4060813 |
| InChI | 1S/C20H18OP.ClH/c21-16-17-22(18-10-4-1-5-11-18,19-12-6-2-7-13-19)20-14-8-3-9-15-20;/h1-16H,17H2;1H/q+1;/p-1 |
| InChIKey | RVEJRPJGKXTQIF-UHFFFAOYSA-M |
| SMILES | [Cl-].O=CC[P+](c1ccccc1)(c2ccccc2)c3ccccc3 |
| CAS DataBase Reference | 62942-43-2(CAS DataBase Reference) |
Description and Uses
Reactant for:• ;Hydroazidation reactions in preparation of a-azido alcohols1• ;Preparation of prodrug (2-hydroxyamino-vinyl)-triphenyl-phosphonium (HVTP) inhibitor of peroxidase activity and apoptosis2• ;Intramolecular [4 + 3] cycloaddition reactions3
Safety
| Symbol(GHS) | ![]() ![]() GHS05,GHS07 |
| Signal word | Danger |
| Hazard statements | H302-H318 |
| Precautionary statements | P264-P270-P280-P301+P312-P305+P351+P338-P501 |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xn,C |
| Risk Statements | 22-41-34 |
| Safety Statements | 26-39-45-36/37/39-27 |
| RIDADR | 1759 |
| WGK Germany | 3 |
| F | 10 |
| HazardClass | 8 |
| PackingGroup | III |
| HS Code | 29319090 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral Eye Dam. 1 |







