A5157412
(<I>tert</I>-<WBR>Butoxycarbonylmethyl)<WBR>triphenylphosphonium chloride , 98% , 35000-37-4
| Pack Size | Price | Stock | Quantity |
| 5g | RMB143.20 | In Stock |
|
| 25G | RMB431.20 | In Stock |
|
| 100g | RMB1519.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 191-193°C |
| vapor pressure | 0.001Pa at 20℃ |
| form | solid |
| BRN | 4116684 |
| InChI | 1S/C24H26O2P.ClH/c1-24(2,3)26-23(25)19-27(20-13-7-4-8-14-20,21-15-9-5-10-16-21)22-17-11-6-12-18-22;/h4-18H,19H2,1-3H3;1H/q+1;/p-1 |
| InChIKey | PWEGQXPODNSKMU-UHFFFAOYSA-M |
| SMILES | [Cl-].CC(C)(C)OC(=O)C[P+](c1ccccc1)(c2ccccc2)c3ccccc3 |
| Surface tension | 70.5mN/m at 1g/L and 20.1℃ |
| CAS DataBase Reference | 35000-37-4(CAS DataBase Reference) |
Description and Uses
Reactant for:
- Stereoselective preparation of (arylamino)quinazoline derivatives bearing tethered acrylamide moieties as inhibitors of epidermal growth factor receptor and histone deacetylase
- Thermal decomposition reactions
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P305+P351+P338-P280g-P337+P313-P403+P233-P405-P501a |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| WGK Germany | 3 |
| F | 3-9 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |






